C13H20O2 — CID 153375411
3-hydroxybutan-2-one;1,2,4-trimethylbenzene (PubChem CID 153375411) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 3-hydroxybutan-2-one;1,2,4-trimethylbenzene.
| Compound Name | 3-hydroxybutan-2-one;1,2,4-trimethylbenzene |
|---|---|
| PubChem CID | 153375411 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 3-hydroxybutan-2-one;1,2,4-trimethylbenzene |
| SMILES | CC(=O)C(C)O.Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C9H12.C4H8O2/c1-7-4-5-8(2)9(3)6-7;1-3(5)4(2)6/h4-6H,1-3H3;3,5H,1-2H3 |
| InChIKey | HVYLQVJRQMFEBP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |