C17H17BrO2S — CID 64637250
1-(4-bromophenyl)-2-(2,5-dimethylphenyl)sulfinylpropan-1-one (PubChem CID 64637250) has the molecular formula C17H17BrO2S and a molecular weight of 365.29 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(2,5-dimethylphenyl)sulfinylpropan-1-one.
| Compound Name | 1-(4-bromophenyl)-2-(2,5-dimethylphenyl)sulfinylpropan-1-one |
|---|---|
| PubChem CID | 64637250 |
| Molecular Formula | C17H17BrO2S |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 1-(4-bromophenyl)-2-(2,5-dimethylphenyl)sulfinylpropan-1-one |
| SMILES | Cc1ccc(C)c(S(=O)C(C)C(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H17BrO2S/c1-11-4-5-12(2)16(10-11)21(20)13(3)17(19)14-6-8-15(18)9-7-14/h4-10,13H,1-3H3 |
| InChIKey | XGOYPIBBQSFCRS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |