C16H15BrO2S — CID 64637079
1-(4-bromophenyl)-2-(2,5-dimethylphenyl)sulfinylethanone (PubChem CID 64637079) has the molecular formula C16H15BrO2S and a molecular weight of 351.27 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(2,5-dimethylphenyl)sulfinylethanone.
| Compound Name | 1-(4-bromophenyl)-2-(2,5-dimethylphenyl)sulfinylethanone |
|---|---|
| PubChem CID | 64637079 |
| Molecular Formula | C16H15BrO2S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 1-(4-bromophenyl)-2-(2,5-dimethylphenyl)sulfinylethanone |
| SMILES | Cc1ccc(C)c(S(=O)CC(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C16H15BrO2S/c1-11-3-4-12(2)16(9-11)20(19)10-15(18)13-5-7-14(17)8-6-13/h3-9H,10H2,1-2H3 |
| InChIKey | GBNZBIPPNYZWST-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |