C14H20N2O2S — CID 81191900
2-(4-amino-2-methylphenyl)sulfinyl-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 81191900) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-(4-amino-2-methylphenyl)sulfinyl-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 2-(4-amino-2-methylphenyl)sulfinyl-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 81191900 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-(4-amino-2-methylphenyl)sulfinyl-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | Cc1cc(N)ccc1S(=O)C(C)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H20N2O2S/c1-10-9-12(15)5-6-13(10)19(18)11(2)14(17)16-7-3-4-8-16/h5-6,9,11H,3-4,7-8,15H2,1-2H3 |
| InChIKey | ZCERDLCNEYJZPO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|