C13H19N3O3S — CID 81193311
2-(4-amino-2-methylphenyl)sulfinyl-N-(ethylcarbamoyl)propanamide (PubChem CID 81193311) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-(4-amino-2-methylphenyl)sulfinyl-N-(ethylcarbamoyl)propanamide.
| Compound Name | 2-(4-amino-2-methylphenyl)sulfinyl-N-(ethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 81193311 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(4-amino-2-methylphenyl)sulfinyl-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)S(=O)c1ccc(N)cc1C |
| InChI | InChI=1S/C13H19N3O3S/c1-4-15-13(18)16-12(17)9(3)20(19)11-6-5-10(14)7-8(11)2/h5-7,9H,4,14H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | XRBSWAQCXCJMAW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|