C23H23NOS — CID 62706068
(2R)-2-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]-2-(2-methylprop-2-enyl)hex-4-ynenitrile (PubChem CID 62706068) has the molecular formula C23H23NOS and a molecular weight of 361.51 g/mol. Its IUPAC name is (2R)-2-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]-2-(2-methylprop-2-enyl)hex-4-ynenitrile.
| Compound Name | (2R)-2-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]-2-(2-methylprop-2-enyl)hex-4-ynenitrile |
|---|---|
| PubChem CID | 62706068 |
| Molecular Formula | C23H23NOS |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (2R)-2-[2-[(S)-(4-methylphenyl)sulfinyl]phenyl]-2-(2-methylprop-2-enyl)hex-4-ynenitrile |
| SMILES | C=C(C)C[C@@](C#N)(CC#CC)c1ccccc1[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H23NOS/c1-5-6-15-23(17-24,16-18(2)3)21-9-7-8-10-22(21)26(25)20-13-11-19(4)12-14-20/h7-14H,2,15-16H2,1,3-4H3/t23-,26+/m1/s1 |
| InChIKey | WUJRGCJPZBJCOG-BVAGGSTKSA-N |
| XLogP | 5.30 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|