C24H23NO4S — CID 162399078
[(1R)-3-[2-(4-methylphenyl)sulfinylanilino]-3-oxo-1-phenylpropyl] acetate (PubChem CID 162399078) has the molecular formula C24H23NO4S and a molecular weight of 421.52 g/mol. Its IUPAC name is [(1R)-3-[2-(4-methylphenyl)sulfinylanilino]-3-oxo-1-phenylpropyl] acetate.
| Compound Name | [(1R)-3-[2-(4-methylphenyl)sulfinylanilino]-3-oxo-1-phenylpropyl] acetate |
|---|---|
| PubChem CID | 162399078 |
| Molecular Formula | C24H23NO4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [(1R)-3-[2-(4-methylphenyl)sulfinylanilino]-3-oxo-1-phenylpropyl] acetate |
| SMILES | CC(=O)O[C@H](CC(=O)Nc1ccccc1S(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO4S/c1-17-12-14-20(15-13-17)30(28)23-11-7-6-10-21(23)25-24(27)16-22(29-18(2)26)19-8-4-3-5-9-19/h3-15,22H,16H2,1-2H3,(H,25,27)/t22-,30?/m1/s1 |
| InChIKey | OLOLTQZVYRONTG-VWRCBCJMSA-N |
| XLogP | 4.79 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |