C19H22ClNO2S — CID 101366875
4-chloro-N,N-dimethyl-4-(4-methylphenyl)sulfinyl-3-phenylbutanamide (PubChem CID 101366875) has the molecular formula C19H22ClNO2S and a molecular weight of 363.91 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-4-(4-methylphenyl)sulfinyl-3-phenylbutanamide.
| Compound Name | 4-chloro-N,N-dimethyl-4-(4-methylphenyl)sulfinyl-3-phenylbutanamide |
|---|---|
| PubChem CID | 101366875 |
| Molecular Formula | C19H22ClNO2S |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 4-chloro-N,N-dimethyl-4-(4-methylphenyl)sulfinyl-3-phenylbutanamide |
| SMILES | Cc1ccc(S(=O)C(Cl)C(CC(=O)N(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22ClNO2S/c1-14-9-11-16(12-10-14)24(23)19(20)17(13-18(22)21(2)3)15-7-5-4-6-8-15/h4-12,17,19H,13H2,1-3H3 |
| InChIKey | JPAYVXBCUGHEKH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|