C22H23ClO5 — CID 7321821
dimethyl 2-[(1S,2R)-1-(4-chlorophenyl)-2-methyl-3-(4-methylphenyl)-3-oxopropyl]propanedioate (PubChem CID 7321821) has the molecular formula C22H23ClO5 and a molecular weight of 402.87 g/mol. Its IUPAC name is dimethyl 2-[(1S,2R)-1-(4-chlorophenyl)-2-methyl-3-(4-methylphenyl)-3-oxopropyl]propanedioate.
| Compound Name | dimethyl 2-[(1S,2R)-1-(4-chlorophenyl)-2-methyl-3-(4-methylphenyl)-3-oxopropyl]propanedioate |
|---|---|
| PubChem CID | 7321821 |
| Molecular Formula | C22H23ClO5 |
| Molecular Weight | 402.87 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | dimethyl 2-[(1S,2R)-1-(4-chlorophenyl)-2-methyl-3-(4-methylphenyl)-3-oxopropyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H](c1ccc(Cl)cc1)[C@@H](C)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H23ClO5/c1-13-5-7-16(8-6-13)20(24)14(2)18(15-9-11-17(23)12-10-15)19(21(25)27-3)22(26)28-4/h5-12,14,18-19H,1-4H3/t14-,18-/m1/s1 |
| InChIKey | AGZBEALVOQHHPK-RDTXWAMCSA-N |
| XLogP | 4.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.87 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|