C21H20ClFO5 — CID 7323322
dimethyl 2-[(1R,2R)-1-(4-chlorophenyl)-3-(4-fluorophenyl)-2-methyl-3-oxopropyl]propanedioate (PubChem CID 7323322) has the molecular formula C21H20ClFO5 and a molecular weight of 406.84 g/mol. Its IUPAC name is dimethyl 2-[(1R,2R)-1-(4-chlorophenyl)-3-(4-fluorophenyl)-2-methyl-3-oxopropyl]propanedioate.
| Compound Name | dimethyl 2-[(1R,2R)-1-(4-chlorophenyl)-3-(4-fluorophenyl)-2-methyl-3-oxopropyl]propanedioate |
|---|---|
| PubChem CID | 7323322 |
| Molecular Formula | C21H20ClFO5 |
| Molecular Weight | 406.84 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | dimethyl 2-[(1R,2R)-1-(4-chlorophenyl)-3-(4-fluorophenyl)-2-methyl-3-oxopropyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](c1ccc(Cl)cc1)[C@@H](C)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H20ClFO5/c1-12(19(24)14-6-10-16(23)11-7-14)17(13-4-8-15(22)9-5-13)18(20(25)27-2)21(26)28-3/h4-12,17-18H,1-3H3/t12-,17+/m1/s1 |
| InChIKey | DHEZNKQKDUUNSG-PXAZEXFGSA-N |
| XLogP | 4.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.84 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|