C21H34O3SSi — CID 101023111
trans-ethyl (1S,2S)-2-[(1R)-1-(4-methylphenyl)sulfinyl-2-trimethylsilylethyl]cyclohexane-1-carboxylate (PubChem CID 101023111) has the molecular formula C21H34O3SSi and a molecular weight of 394.65 g/mol. Its IUPAC name is trans-ethyl (1S,2S)-2-[(1R)-1-(4-methylphenyl)sulfinyl-2-trimethylsilylethyl]cyclohexane-1-carboxylate.
| Compound Name | trans-ethyl (1S,2S)-2-[(1R)-1-(4-methylphenyl)sulfinyl-2-trimethylsilylethyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 101023111 |
| Molecular Formula | C21H34O3SSi |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | trans-ethyl (1S,2S)-2-[(1R)-1-(4-methylphenyl)sulfinyl-2-trimethylsilylethyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCC[C@@H]1[C@H](C[Si](C)(C)C)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H34O3SSi/c1-6-24-21(22)19-10-8-7-9-18(19)20(15-26(3,4)5)25(23)17-13-11-16(2)12-14-17/h11-14,18-20H,6-10,15H2,1-5H3/t18-,19-,20-,25?/m0/s1 |
| InChIKey | OEAQTJCAIBVWND-NRNPOHGYSA-N |
| XLogP | 5.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|