C14H17O5S- — CID 91227835
[(2-ethoxycarbonylcyclopropyl)-(4-methylphenyl)methyl] sulfite (PubChem CID 91227835) has the molecular formula C14H17O5S- and a molecular weight of 297.35 g/mol. Its IUPAC name is [(2-ethoxycarbonylcyclopropyl)-(4-methylphenyl)methyl] sulfite.
| Compound Name | [(2-ethoxycarbonylcyclopropyl)-(4-methylphenyl)methyl] sulfite |
|---|---|
| PubChem CID | 91227835 |
| Molecular Formula | C14H17O5S- |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | [(2-ethoxycarbonylcyclopropyl)-(4-methylphenyl)methyl] sulfite |
| SMILES | CCOC(=O)C1CC1C(OS(=O)[O-])c1ccc(C)cc1 |
| InChI | InChI=1S/C14H18O5S/c1-3-18-14(15)12-8-11(12)13(19-20(16)17)10-6-4-9(2)5-7-10/h4-7,11-13H,3,8H2,1-2H3,(H,16,17)/p-1 |
| InChIKey | DYJDKAPDMVMEIN-UHFFFAOYSA-M |
| XLogP | 2.05 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|