C19H30O3SSi — CID 102463367
cis-ethyl (1R,2S)-2-[(1R)-1-(4-methylphenyl)sulfinyl-2-trimethylsilylethyl]cyclobutane-1-carboxylate (PubChem CID 102463367) has the molecular formula C19H30O3SSi and a molecular weight of 366.60 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-[(1R)-1-(4-methylphenyl)sulfinyl-2-trimethylsilylethyl]cyclobutane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-2-[(1R)-1-(4-methylphenyl)sulfinyl-2-trimethylsilylethyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 102463367 |
| Molecular Formula | C19H30O3SSi |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | cis-ethyl (1R,2S)-2-[(1R)-1-(4-methylphenyl)sulfinyl-2-trimethylsilylethyl]cyclobutane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@@H]1[C@H](C[Si](C)(C)C)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H30O3SSi/c1-6-22-19(20)17-12-11-16(17)18(13-24(3,4)5)23(21)15-9-7-14(2)8-10-15/h7-10,16-18H,6,11-13H2,1-5H3/t16-,17+,18-,23?/m0/s1 |
| InChIKey | NSHYGZARVCYOOZ-XQQZOSOQSA-N |
| XLogP | 4.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|