C20H22NO5S- — CID 91505551
[(4-methylphenyl)-(1-phenylmethoxycarbonylpyrrolidin-2-yl)methyl] sulfite (PubChem CID 91505551) has the molecular formula C20H22NO5S- and a molecular weight of 388.47 g/mol. Its IUPAC name is [(4-methylphenyl)-(1-phenylmethoxycarbonylpyrrolidin-2-yl)methyl] sulfite.
| Compound Name | [(4-methylphenyl)-(1-phenylmethoxycarbonylpyrrolidin-2-yl)methyl] sulfite |
|---|---|
| PubChem CID | 91505551 |
| Molecular Formula | C20H22NO5S- |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [(4-methylphenyl)-(1-phenylmethoxycarbonylpyrrolidin-2-yl)methyl] sulfite |
| SMILES | Cc1ccc(C(OS(=O)[O-])C2CCCN2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO5S/c1-15-9-11-17(12-10-15)19(26-27(23)24)18-8-5-13-21(18)20(22)25-14-16-6-3-2-4-7-16/h2-4,6-7,9-12,18-19H,5,8,13-14H2,1H3,(H,23,24)/p-1 |
| InChIKey | UTEYTACTCYKGBT-UHFFFAOYSA-M |
| XLogP | 3.65 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|