C14H18NNaO4S — CID 165454151
sodium (1-phenylmethoxycarbonylpiperidin-2-yl)methanesulfinate (PubChem CID 165454151) has the molecular formula C14H18NNaO4S and a molecular weight of 319.36 g/mol. Its IUPAC name is sodium (1-phenylmethoxycarbonylpiperidin-2-yl)methanesulfinate.
| Compound Name | sodium (1-phenylmethoxycarbonylpiperidin-2-yl)methanesulfinate |
|---|---|
| PubChem CID | 165454151 |
| Molecular Formula | C14H18NNaO4S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | sodium (1-phenylmethoxycarbonylpiperidin-2-yl)methanesulfinate |
| SMILES | O=C(OCc1ccccc1)N1CCCCC1CS(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H19NO4S.Na/c16-14(19-10-12-6-2-1-3-7-12)15-9-5-4-8-13(15)11-20(17)18;/h1-3,6-7,13H,4-5,8-11H2,(H,17,18);/q;+1/p-1 |
| InChIKey | LGTVGSLVNWMPCO-UHFFFAOYSA-M |
| XLogP | -0.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|