About trans-ethyl (1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylate
trans-ethyl (1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylate (PubChem CID 131213145) has the molecular formula C7H10F2O2
and a molecular weight of 164.15 g/mol. Its IUPAC name is trans-ethyl (1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylate.
Analyze trans-ethyl (1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-ethyl (1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylate?
The IUPAC name of trans-ethyl (1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylate (CID 131213145) is trans-ethyl (1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylate.
What is the SMILES notation for trans-ethyl (1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylate?
The canonical SMILES for trans-ethyl (1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylate is CCOC(=O)[C@H]1C[C@@H]1C(F)F.
What is the InChIKey of trans-ethyl (1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylate?
The InChIKey is LUUSYESYLFJQHB-WHFBIAKZSA-N. The full InChI is InChI=1S/C7H10F2O2/c1-2-11-7(10)5-3-4(5)6(8)9/h4-6H,2-3H2,1H3/t4-,5-/m0/s1.
What are the key properties of trans-ethyl (1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylate?
trans-ethyl (1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylate has a molecular weight of 164.15 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-ethyl (1S,2S)-2-(difluoromethyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 131213145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).