C13H18O3S — CID 23259855
1-[(Z)-4,4-dimethoxybut-2-en-2-yl]sulfinyl-4-methylbenzene (PubChem CID 23259855) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is 1-[(Z)-4,4-dimethoxybut-2-en-2-yl]sulfinyl-4-methylbenzene.
| Compound Name | 1-[(Z)-4,4-dimethoxybut-2-en-2-yl]sulfinyl-4-methylbenzene |
|---|---|
| PubChem CID | 23259855 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 1-[(Z)-4,4-dimethoxybut-2-en-2-yl]sulfinyl-4-methylbenzene |
| SMILES | COC(/C=C(/C)S(=O)c1ccc(C)cc1)OC |
| InChI | InChI=1S/C13H18O3S/c1-10-5-7-12(8-6-10)17(14)11(2)9-13(15-3)16-4/h5-9,13H,1-4H3/b11-9- |
| InChIKey | XYDVJBFHBFAYRG-LUAWRHEFSA-N |
| XLogP | 2.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|