About methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate
methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate (PubChem CID 67457029) has the molecular formula C13H16O5S
and a molecular weight of 284.33 g/mol. Its IUPAC name is methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate |
| PubChem CID | 67457029 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate |
| SMILES | COC(=O)/C(=C/C(OC)OC)S(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16O5S/c1-16-12(17-2)9-11(13(14)18-3)19(15)10-7-5-4-6-8-10/h4-9,12H,1-3H3/b11-9- |
| InChIKey | JVDILDBLUZBMRH-LUAWRHEFSA-N |
| XLogP | 1.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate?
The IUPAC name of methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate (CID 67457029) is methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate.
What is the SMILES notation for methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate?
The canonical SMILES for methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate is COC(=O)/C(=C/C(OC)OC)S(=O)c1ccccc1.
What is the InChIKey of methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate?
The InChIKey is JVDILDBLUZBMRH-LUAWRHEFSA-N. The full InChI is InChI=1S/C13H16O5S/c1-16-12(17-2)9-11(13(14)18-3)19(15)10-7-5-4-6-8-10/h4-9,12H,1-3H3/b11-9-.
What are the key properties of methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate?
methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate has a molecular weight of 284.33 g/mol, XLogP of 1.47, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-2-(benzenesulfinyl)-4,4-dimethoxybut-2-enoate is sourced from PubChem (CID 67457029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).