C20H22O2S — CID 10687599
(2S,3S)-2-[(E)-3-methyl-1-[(R)-(4-methylphenyl)sulfinyl]but-1-enyl]-3-phenyloxirane (PubChem CID 10687599) has the molecular formula C20H22O2S and a molecular weight of 326.46 g/mol. Its IUPAC name is (2S,3S)-2-[(E)-3-methyl-1-[(R)-(4-methylphenyl)sulfinyl]but-1-enyl]-3-phenyloxirane.
| Compound Name | (2S,3S)-2-[(E)-3-methyl-1-[(R)-(4-methylphenyl)sulfinyl]but-1-enyl]-3-phenyloxirane |
|---|---|
| PubChem CID | 10687599 |
| Molecular Formula | C20H22O2S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (2S,3S)-2-[(E)-3-methyl-1-[(R)-(4-methylphenyl)sulfinyl]but-1-enyl]-3-phenyloxirane |
| SMILES | Cc1ccc([S@@](=O)/C(=C/C(C)C)[C@H]2O[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22O2S/c1-14(2)13-18(23(21)17-11-9-15(3)10-12-17)20-19(22-20)16-7-5-4-6-8-16/h4-14,19-20H,1-3H3/b18-13+/t19-,20+,23+/m0/s1 |
| InChIKey | RMASSZIUHSMACW-LCIXIOIESA-N |
| XLogP | 4.78 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|