C17H15BrClNO4S — CID 101421926
methyl 2-[[(2-bromophenyl)sulfonylamino]-(4-chlorophenyl)methyl]prop-2-enoate (PubChem CID 101421926) has the molecular formula C17H15BrClNO4S and a molecular weight of 444.73 g/mol. Its IUPAC name is methyl 2-[[(2-bromophenyl)sulfonylamino]-(4-chlorophenyl)methyl]prop-2-enoate.
| Compound Name | methyl 2-[[(2-bromophenyl)sulfonylamino]-(4-chlorophenyl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 101421926 |
| Molecular Formula | C17H15BrClNO4S |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 442.96 |
| IUPAC Name | methyl 2-[[(2-bromophenyl)sulfonylamino]-(4-chlorophenyl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(NS(=O)(=O)c1ccccc1Br)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15BrClNO4S/c1-11(17(21)24-2)16(12-7-9-13(19)10-8-12)20-25(22,23)15-6-4-3-5-14(15)18/h3-10,16,20H,1H2,2H3 |
| InChIKey | AHUUENZFYNLPAP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|