C13H14ClNO4 — CID 102356900
methyl 2-[(4-chlorophenyl)-(methoxycarbonylamino)methyl]prop-2-enoate (PubChem CID 102356900) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is methyl 2-[(4-chlorophenyl)-(methoxycarbonylamino)methyl]prop-2-enoate.
| Compound Name | methyl 2-[(4-chlorophenyl)-(methoxycarbonylamino)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 102356900 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | methyl 2-[(4-chlorophenyl)-(methoxycarbonylamino)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(NC(=O)OC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14ClNO4/c1-8(12(16)18-2)11(15-13(17)19-3)9-4-6-10(14)7-5-9/h4-7,11H,1H2,2-3H3,(H,15,17) |
| InChIKey | GZFNRLPCSMEZEX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|