C19H22ClNO3 — CID 154707568
tert-butyl N-[1-(4-chlorophenyl)-2-(3-oxocyclopenten-1-yl)prop-2-enyl]carbamate (PubChem CID 154707568) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is tert-butyl N-[1-(4-chlorophenyl)-2-(3-oxocyclopenten-1-yl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[1-(4-chlorophenyl)-2-(3-oxocyclopenten-1-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 154707568 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | tert-butyl N-[1-(4-chlorophenyl)-2-(3-oxocyclopenten-1-yl)prop-2-enyl]carbamate |
| SMILES | C=C(C1=CC(=O)CC1)C(NC(=O)OC(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO3/c1-12(14-7-10-16(22)11-14)17(13-5-8-15(20)9-6-13)21-18(23)24-19(2,3)4/h5-6,8-9,11,17H,1,7,10H2,2-4H3,(H,21,23) |
| InChIKey | YHKJUTXPWTXUFW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |