C17H17ClN4O4 — CID 100965257
methyl N-[[2-(2-benzoylhydrazinyl)-1-(4-chlorophenyl)-2-oxoethyl]amino]carbamate (PubChem CID 100965257) has the molecular formula C17H17ClN4O4 and a molecular weight of 376.80 g/mol. Its IUPAC name is methyl N-[[2-(2-benzoylhydrazinyl)-1-(4-chlorophenyl)-2-oxoethyl]amino]carbamate.
| Compound Name | methyl N-[[2-(2-benzoylhydrazinyl)-1-(4-chlorophenyl)-2-oxoethyl]amino]carbamate |
|---|---|
| PubChem CID | 100965257 |
| Molecular Formula | C17H17ClN4O4 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | methyl N-[[2-(2-benzoylhydrazinyl)-1-(4-chlorophenyl)-2-oxoethyl]amino]carbamate |
| SMILES | COC(=O)NNC(C(=O)NNC(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN4O4/c1-26-17(25)22-19-14(11-7-9-13(18)10-8-11)16(24)21-20-15(23)12-5-3-2-4-6-12/h2-10,14,19H,1H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | PJRRCWYKLGVYSJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|