C17H16ClN3O4S — CID 72821314
methyl 3-(4-chlorophenyl)-2-diazo-3-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 72821314) has the molecular formula C17H16ClN3O4S and a molecular weight of 393.85 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-2-diazo-3-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-2-diazo-3-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 72821314 |
| Molecular Formula | C17H16ClN3O4S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-2-diazo-3-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(=[N+]=[N-])C(NS(=O)(=O)c1ccc(C)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClN3O4S/c1-11-3-9-14(10-4-11)26(23,24)21-15(16(20-19)17(22)25-2)12-5-7-13(18)8-6-12/h3-10,15,21H,1-2H3 |
| InChIKey | OPUQEVCPFSBWPE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|