C17H17ClN3O4S+ — CID 11372807
(Z)-3-(4-chlorophenyl)-1-hydroxy-1-methoxy-3-[(4-methylphenyl)sulfonylamino]prop-1-ene-2-diazonium (PubChem CID 11372807) has the molecular formula C17H17ClN3O4S+ and a molecular weight of 394.86 g/mol. Its IUPAC name is (Z)-3-(4-chlorophenyl)-1-hydroxy-1-methoxy-3-[(4-methylphenyl)sulfonylamino]prop-1-ene-2-diazonium.
| Compound Name | (Z)-3-(4-chlorophenyl)-1-hydroxy-1-methoxy-3-[(4-methylphenyl)sulfonylamino]prop-1-ene-2-diazonium |
|---|---|
| PubChem CID | 11372807 |
| Molecular Formula | C17H17ClN3O4S+ |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | (Z)-3-(4-chlorophenyl)-1-hydroxy-1-methoxy-3-[(4-methylphenyl)sulfonylamino]prop-1-ene-2-diazonium |
| SMILES | CO/C(O)=C(\[N+]#N)C(NS(=O)(=O)c1ccc(C)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClN3O4S/c1-11-3-9-14(10-4-11)26(23,24)21-15(16(20-19)17(22)25-2)12-5-7-13(18)8-6-12/h3-10,15,21H,1-2H3/p+1/b17-16- |
| InChIKey | OPUQEVCPFSBWPE-MSUUIHNZSA-O |
| XLogP | 3.89 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|