C20H15Cl4NO3S — CID 54771421
4-chloro-N-[2,2-dichloro-1-(4-chlorophenoxy)-2-phenylethyl]benzenesulfonamide (PubChem CID 54771421) has the molecular formula C20H15Cl4NO3S and a molecular weight of 491.22 g/mol. Its IUPAC name is 4-chloro-N-[2,2-dichloro-1-(4-chlorophenoxy)-2-phenylethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2,2-dichloro-1-(4-chlorophenoxy)-2-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54771421 |
| Molecular Formula | C20H15Cl4NO3S |
| Molecular Weight | 491.22 g/mol |
| Exact Mass | 488.95 |
| IUPAC Name | 4-chloro-N-[2,2-dichloro-1-(4-chlorophenoxy)-2-phenylethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC(Oc1ccc(Cl)cc1)C(Cl)(Cl)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15Cl4NO3S/c21-15-6-10-17(11-7-15)28-19(20(23,24)14-4-2-1-3-5-14)25-29(26,27)18-12-8-16(22)9-13-18/h1-13,19,25H |
| InChIKey | APFMIBYFPZRZQN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.22 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|