C10H10Cl3NO4S — CID 3068217
[1-(benzenesulfonamido)-2,2,2-trichloroethyl] acetate (PubChem CID 3068217) has the molecular formula C10H10Cl3NO4S and a molecular weight of 346.62 g/mol. Its IUPAC name is [1-(benzenesulfonamido)-2,2,2-trichloroethyl] acetate.
| Compound Name | [1-(benzenesulfonamido)-2,2,2-trichloroethyl] acetate |
|---|---|
| PubChem CID | 3068217 |
| Molecular Formula | C10H10Cl3NO4S |
| Molecular Weight | 346.62 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | [1-(benzenesulfonamido)-2,2,2-trichloroethyl] acetate |
| SMILES | CC(=O)OC(NS(=O)(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H10Cl3NO4S/c1-7(15)18-9(10(11,12)13)14-19(16,17)8-5-3-2-4-6-8/h2-6,9,14H,1H3 |
| InChIKey | OKDBWAPSCJVJCT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.62 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|