About [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate
[(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate (PubChem CID 2325808) has the molecular formula C16H14Cl3NO4S
and a molecular weight of 422.72 g/mol. Its IUPAC name is [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate.
Molecular Properties
| Compound Name | [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate |
| PubChem CID | 2325808 |
| Molecular Formula | C16H14Cl3NO4S |
| Molecular Weight | 422.72 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate |
| SMILES | O=C(O[C@@H](CNS(=O)(=O)c1ccccc1)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H14Cl3NO4S/c17-16(18,19)15(21)24-14(12-7-3-1-4-8-12)11-20-25(22,23)13-9-5-2-6-10-13/h1-10,14,20H,11H2/t14-/m0/s1 |
| InChIKey | OSXDAJURWCRAEC-AWEZNQCLSA-N |
| XLogP | 3.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.72 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate?
The IUPAC name of [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate (CID 2325808) is [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate.
What is the SMILES notation for [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate?
The canonical SMILES for [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate is O=C(O[C@@H](CNS(=O)(=O)c1ccccc1)c1ccccc1)C(Cl)(Cl)Cl.
What is the InChIKey of [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate?
The InChIKey is OSXDAJURWCRAEC-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H14Cl3NO4S/c17-16(18,19)15(21)24-14(12-7-3-1-4-8-12)11-20-25(22,23)13-9-5-2-6-10-13/h1-10,14,20H,11H2/t14-/m0/s1.
What are the key properties of [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate?
[(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate has a molecular weight of 422.72 g/mol, XLogP of 3.62, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate is sourced from PubChem (CID 2325808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).