C16H14Cl3NO4S — CID 2325808
[(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate (PubChem CID 2325808) has the molecular formula C16H14Cl3NO4S and a molecular weight of 422.72 g/mol. Its IUPAC name is [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate.
| Compound Name | [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 2325808 |
| Molecular Formula | C16H14Cl3NO4S |
| Molecular Weight | 422.72 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | [(1R)-2-(benzenesulfonamido)-1-phenylethyl] 2,2,2-trichloroacetate |
| SMILES | O=C(O[C@@H](CNS(=O)(=O)c1ccccc1)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H14Cl3NO4S/c17-16(18,19)15(21)24-14(12-7-3-1-4-8-12)11-20-25(22,23)13-9-5-2-6-10-13/h1-10,14,20H,11H2/t14-/m0/s1 |
| InChIKey | OSXDAJURWCRAEC-AWEZNQCLSA-N |
| XLogP | 3.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.72 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|