C14H17Cl3N2O3S — CID 15566974
N-[2,2,2-trichloro-1-(cyclohexylideneamino)oxyethyl]benzenesulfonamide (PubChem CID 15566974) has the molecular formula C14H17Cl3N2O3S and a molecular weight of 399.73 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(cyclohexylideneamino)oxyethyl]benzenesulfonamide.
| Compound Name | N-[2,2,2-trichloro-1-(cyclohexylideneamino)oxyethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 15566974 |
| Molecular Formula | C14H17Cl3N2O3S |
| Molecular Weight | 399.73 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | N-[2,2,2-trichloro-1-(cyclohexylideneamino)oxyethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC(ON=C1CCCCC1)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C14H17Cl3N2O3S/c15-14(16,17)13(22-18-11-7-3-1-4-8-11)19-23(20,21)12-9-5-2-6-10-12/h2,5-6,9-10,13,19H,1,3-4,7-8H2 |
| InChIKey | UHTXIXXEZSZWNR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.73 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|