C11H12Cl3NO3S — CID 15312074
N-(2,2,2-trichloro-1-prop-2-enoxyethyl)benzenesulfonamide (PubChem CID 15312074) has the molecular formula C11H12Cl3NO3S and a molecular weight of 344.65 g/mol. Its IUPAC name is N-(2,2,2-trichloro-1-prop-2-enoxyethyl)benzenesulfonamide.
| Compound Name | N-(2,2,2-trichloro-1-prop-2-enoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 15312074 |
| Molecular Formula | C11H12Cl3NO3S |
| Molecular Weight | 344.65 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | N-(2,2,2-trichloro-1-prop-2-enoxyethyl)benzenesulfonamide |
| SMILES | C=CCOC(NS(=O)(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H12Cl3NO3S/c1-2-8-18-10(11(12,13)14)15-19(16,17)9-6-4-3-5-7-9/h2-7,10,15H,1,8H2 |
| InChIKey | LCIINYVOKPPWNZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.65 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|