C10H9Cl4N3O2S3 — CID 102055098
N'-[2,2,2-trichloro-1-[(4-chlorophenyl)sulfonylamino]ethyl]ethanedithioamide (PubChem CID 102055098) has the molecular formula C10H9Cl4N3O2S3 and a molecular weight of 441.21 g/mol. Its IUPAC name is N'-[2,2,2-trichloro-1-[(4-chlorophenyl)sulfonylamino]ethyl]ethanedithioamide.
| Compound Name | N'-[2,2,2-trichloro-1-[(4-chlorophenyl)sulfonylamino]ethyl]ethanedithioamide |
|---|---|
| PubChem CID | 102055098 |
| Molecular Formula | C10H9Cl4N3O2S3 |
| Molecular Weight | 441.21 g/mol |
| Exact Mass | 438.86 |
| IUPAC Name | N'-[2,2,2-trichloro-1-[(4-chlorophenyl)sulfonylamino]ethyl]ethanedithioamide |
| SMILES | NC(=S)C(=S)NC(NS(=O)(=O)c1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H9Cl4N3O2S3/c11-5-1-3-6(4-2-5)22(18,19)17-9(10(12,13)14)16-8(21)7(15)20/h1-4,9,17H,(H2,15,20)(H,16,21) |
| InChIKey | ZYZGPSCLRICCJR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|