C15H12Cl4N2O4S — CID 15526171
2-hydroxy-5-[2,2,2-trichloro-1-[(4-chlorophenyl)sulfonylamino]ethyl]benzamide (PubChem CID 15526171) has the molecular formula C15H12Cl4N2O4S and a molecular weight of 458.15 g/mol. Its IUPAC name is 2-hydroxy-5-[2,2,2-trichloro-1-[(4-chlorophenyl)sulfonylamino]ethyl]benzamide.
| Compound Name | 2-hydroxy-5-[2,2,2-trichloro-1-[(4-chlorophenyl)sulfonylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 15526171 |
| Molecular Formula | C15H12Cl4N2O4S |
| Molecular Weight | 458.15 g/mol |
| Exact Mass | 455.93 |
| IUPAC Name | 2-hydroxy-5-[2,2,2-trichloro-1-[(4-chlorophenyl)sulfonylamino]ethyl]benzamide |
| SMILES | NC(=O)c1cc(C(NS(=O)(=O)c2ccc(Cl)cc2)C(Cl)(Cl)Cl)ccc1O |
| InChI | InChI=1S/C15H12Cl4N2O4S/c16-9-2-4-10(5-3-9)26(24,25)21-13(15(17,18)19)8-1-6-12(22)11(7-8)14(20)23/h1-7,13,21-22H,(H2,20,23) |
| InChIKey | FKNNFFNBSFNFSP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.15 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|