C13H17ClFNO3S — CID 59000938
4-chloro-N-(5-fluoro-5-methyl-2-oxohexan-3-yl)benzenesulfonamide (PubChem CID 59000938) has the molecular formula C13H17ClFNO3S and a molecular weight of 321.80 g/mol. Its IUPAC name is 4-chloro-N-(5-fluoro-5-methyl-2-oxohexan-3-yl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(5-fluoro-5-methyl-2-oxohexan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 59000938 |
| Molecular Formula | C13H17ClFNO3S |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 4-chloro-N-(5-fluoro-5-methyl-2-oxohexan-3-yl)benzenesulfonamide |
| SMILES | CC(=O)C(CC(C)(C)F)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClFNO3S/c1-9(17)12(8-13(2,3)15)16-20(18,19)11-6-4-10(14)5-7-11/h4-7,12,16H,8H2,1-3H3 |
| InChIKey | JRMIPHCKMYUGQX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |