C20H19Cl2N3O2S — CID 71600510
N-[2,2-dichloro-2-phenyl-1-(pyridin-2-ylamino)ethyl]-4-methylbenzenesulfonamide (PubChem CID 71600510) has the molecular formula C20H19Cl2N3O2S and a molecular weight of 436.36 g/mol. Its IUPAC name is N-[2,2-dichloro-2-phenyl-1-(pyridin-2-ylamino)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2,2-dichloro-2-phenyl-1-(pyridin-2-ylamino)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 71600510 |
| Molecular Formula | C20H19Cl2N3O2S |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | N-[2,2-dichloro-2-phenyl-1-(pyridin-2-ylamino)ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(Nc2ccccn2)C(Cl)(Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O2S/c1-15-10-12-17(13-11-15)28(26,27)25-19(24-18-9-5-6-14-23-18)20(21,22)16-7-3-2-4-8-16/h2-14,19,25H,1H3,(H,23,24) |
| InChIKey | KAVHOKYGFWRGBC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|