C18H17Cl2N3O2S2 — CID 71600641
N-[2,2-dichloro-2-phenyl-1-(1,3-thiazol-2-ylamino)ethyl]-4-methylbenzenesulfonamide (PubChem CID 71600641) has the molecular formula C18H17Cl2N3O2S2 and a molecular weight of 442.39 g/mol. Its IUPAC name is N-[2,2-dichloro-2-phenyl-1-(1,3-thiazol-2-ylamino)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2,2-dichloro-2-phenyl-1-(1,3-thiazol-2-ylamino)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 71600641 |
| Molecular Formula | C18H17Cl2N3O2S2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | N-[2,2-dichloro-2-phenyl-1-(1,3-thiazol-2-ylamino)ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(Nc2nccs2)C(Cl)(Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17Cl2N3O2S2/c1-13-7-9-15(10-8-13)27(24,25)23-16(22-17-21-11-12-26-17)18(19,20)14-5-3-2-4-6-14/h2-12,16,23H,1H3,(H,21,22) |
| InChIKey | SQHBSUXNFCKOKX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|