C14H17N3O3S2 — CID 2118573
(2R)-2-(benzenesulfonamido)-3-methyl-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 2118573) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (2R)-2-(benzenesulfonamido)-3-methyl-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | (2R)-2-(benzenesulfonamido)-3-methyl-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 2118573 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | (2R)-2-(benzenesulfonamido)-3-methyl-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1ccccc1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-10(2)12(13(18)16-14-15-8-9-21-14)17-22(19,20)11-6-4-3-5-7-11/h3-10,12,17H,1-2H3,(H,15,16,18)/t12-/m1/s1 |
| InChIKey | JUXMWDOOFIEIMA-GFCCVEGCSA-N |
| XLogP | 2.08 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |