C11H11ClF6NNaO6S2 — CID 87609755
sodium;4-chloro-N-[(2R)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]benzenesulfonamide;sulfuric acid (PubChem CID 87609755) has the molecular formula C11H11ClF6NNaO6S2 and a molecular weight of 489.78 g/mol. Its IUPAC name is sodium;4-chloro-N-[(2R)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]benzenesulfonamide;sulfuric acid.
| Compound Name | sodium;4-chloro-N-[(2R)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]benzenesulfonamide;sulfuric acid |
|---|---|
| PubChem CID | 87609755 |
| Molecular Formula | C11H11ClF6NNaO6S2 |
| Molecular Weight | 489.78 g/mol |
| Exact Mass | 488.95 |
| IUPAC Name | sodium;4-chloro-N-[(2R)-4,4,4-trifluoro-3-(trifluoromethyl)butan-2-yl]benzenesulfonamide;sulfuric acid |
| SMILES | O=S(=O)(O)O.[CH2-][C@@H](NS(=O)(=O)c1ccc(Cl)cc1)C(C(F)(F)F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C11H9ClF6NO2S.Na.H2O4S/c1-6(9(10(13,14)15)11(16,17)18)19-22(20,21)8-4-2-7(12)3-5-8;;1-5(2,3)4/h2-6,9,19H,1H2;;(H2,1,2,3,4)/q-1;+1;/t6-;;/m1../s1 |
| InChIKey | MZNMHJFVBGNTTH-QYCVXMPOSA-N |
| XLogP | -0.09 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.78 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|