C12H16Cl3NO3S — CID 10406247
2,4,5-trichloro-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]benzenesulfonamide (PubChem CID 10406247) has the molecular formula C12H16Cl3NO3S and a molecular weight of 360.69 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10406247 |
| Molecular Formula | C12H16Cl3NO3S |
| Molecular Weight | 360.69 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 2,4,5-trichloro-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]benzenesulfonamide |
| SMILES | CC(C)(C)[C@@H](CO)NS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl3NO3S/c1-12(2,3)11(6-17)16-20(18,19)10-5-8(14)7(13)4-9(10)15/h4-5,11,16-17H,6H2,1-3H3/t11-/m1/s1 |
| InChIKey | OEHNQMOJPOUGCL-LLVKDONJSA-N |
| XLogP | 3.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.69 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|