C11H20N2O3S — CID 106353453
N-(1-hydroxy-4,4-dimethylpentan-3-yl)-1H-pyrrole-3-sulfonamide (PubChem CID 106353453) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is N-(1-hydroxy-4,4-dimethylpentan-3-yl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(1-hydroxy-4,4-dimethylpentan-3-yl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106353453 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-(1-hydroxy-4,4-dimethylpentan-3-yl)-1H-pyrrole-3-sulfonamide |
| SMILES | CC(C)(C)C(CCO)NS(=O)(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C11H20N2O3S/c1-11(2,3)10(5-7-14)13-17(15,16)9-4-6-12-8-9/h4,6,8,10,12-14H,5,7H2,1-3H3 |
| InChIKey | MJMPJJYAJLWUMH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |