C8H11F3N2O2S — CID 159847586
N-[(2S)-1,1,1-trifluorobutan-2-yl]-1H-pyrrole-3-sulfonamide (PubChem CID 159847586) has the molecular formula C8H11F3N2O2S and a molecular weight of 256.25 g/mol. Its IUPAC name is N-[(2S)-1,1,1-trifluorobutan-2-yl]-1H-pyrrole-3-sulfonamide.
| Compound Name | N-[(2S)-1,1,1-trifluorobutan-2-yl]-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 159847586 |
| Molecular Formula | C8H11F3N2O2S |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | N-[(2S)-1,1,1-trifluorobutan-2-yl]-1H-pyrrole-3-sulfonamide |
| SMILES | CC[C@H](NS(=O)(=O)c1cc[nH]c1)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O2S/c1-2-7(8(9,10)11)13-16(14,15)6-3-4-12-5-6/h3-5,7,12-13H,2H2,1H3/t7-/m0/s1 |
| InChIKey | NPMYLESSHUQPPY-ZETCQYMHSA-N |
| XLogP | 1.63 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |