C12H18N2O3S — CID 20975377
cyclobutane;(2-methylphenyl)sulfonylurea (PubChem CID 20975377) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is cyclobutane;(2-methylphenyl)sulfonylurea.
| Compound Name | cyclobutane;(2-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 20975377 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | cyclobutane;(2-methylphenyl)sulfonylurea |
| SMILES | C1CCC1.Cc1ccccc1S(=O)(=O)NC(N)=O |
| InChI | InChI=1S/C8H10N2O3S.C4H8/c1-6-4-2-3-5-7(6)14(12,13)10-8(9)11;1-2-4-3-1/h2-5H,1H3,(H3,9,10,11);1-4H2 |
| InChIKey | KAKYMHXHFBQAFJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |