C10H13NO4S — CID 763152
(2S)-2-hydroxy-N-(2-methylphenyl)sulfonylpropanamide (PubChem CID 763152) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is (2S)-2-hydroxy-N-(2-methylphenyl)sulfonylpropanamide.
| Compound Name | (2S)-2-hydroxy-N-(2-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 763152 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | (2S)-2-hydroxy-N-(2-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1ccccc1S(=O)(=O)NC(=O)[C@H](C)O |
| InChI | InChI=1S/C10H13NO4S/c1-7-5-3-4-6-9(7)16(14,15)11-10(13)8(2)12/h3-6,8,12H,1-2H3,(H,11,13)/t8-/m0/s1 |
| InChIKey | KLCZKBJJAFGKSR-QMMMGPOBSA-N |
| XLogP | 0.18 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |