C9H10Cl3NO3S — CID 125486356
2-methyl-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]benzenesulfonamide (PubChem CID 125486356) has the molecular formula C9H10Cl3NO3S and a molecular weight of 318.61 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]benzenesulfonamide.
| Compound Name | 2-methyl-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 125486356 |
| Molecular Formula | C9H10Cl3NO3S |
| Molecular Weight | 318.61 g/mol |
| Exact Mass | 316.94 |
| IUPAC Name | 2-methyl-N-[(1R)-2,2,2-trichloro-1-hydroxyethyl]benzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)N[C@H](O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H10Cl3NO3S/c1-6-4-2-3-5-7(6)17(15,16)13-8(14)9(10,11)12/h2-5,8,13-14H,1H3/t8-/m1/s1 |
| InChIKey | XSIUZFJVGFIIQY-MRVPVSSYSA-N |
| XLogP | 1.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.61 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|