C12H12N4O3S — CID 118046361
[2-(4-methylpyrimidin-2-yl)phenyl]sulfonylurea (PubChem CID 118046361) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is [2-(4-methylpyrimidin-2-yl)phenyl]sulfonylurea.
| Compound Name | [2-(4-methylpyrimidin-2-yl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 118046361 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | [2-(4-methylpyrimidin-2-yl)phenyl]sulfonylurea |
| SMILES | Cc1ccnc(-c2ccccc2S(=O)(=O)NC(N)=O)n1 |
| InChI | InChI=1S/C12H12N4O3S/c1-8-6-7-14-11(15-8)9-4-2-3-5-10(9)20(18,19)16-12(13)17/h2-7H,1H3,(H3,13,16,17) |
| InChIKey | ZQSAMVOZCKEULD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |