C13H26N4O2S — CID 119981388
N-[3-(aminomethyl)pentan-3-yl]-1-(2-methylpropyl)imidazole-4-sulfonamide (PubChem CID 119981388) has the molecular formula C13H26N4O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-1-(2-methylpropyl)imidazole-4-sulfonamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-1-(2-methylpropyl)imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 119981388 |
| Molecular Formula | C13H26N4O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-1-(2-methylpropyl)imidazole-4-sulfonamide |
| SMILES | CCC(CC)(CN)NS(=O)(=O)c1cn(CC(C)C)cn1 |
| InChI | InChI=1S/C13H26N4O2S/c1-5-13(6-2,9-14)16-20(18,19)12-8-17(10-15-12)7-11(3)4/h8,10-11,16H,5-7,9,14H2,1-4H3 |
| InChIKey | DEEKGTUVKXGCRV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |