C15H29ClN4O2S — CID 119983755
N-(2-amino-1-cyclohexylethyl)-1-(2-methylpropyl)imidazole-4-sulfonamide;hydrochloride (PubChem CID 119983755) has the molecular formula C15H29ClN4O2S and a molecular weight of 364.94 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-1-(2-methylpropyl)imidazole-4-sulfonamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-1-(2-methylpropyl)imidazole-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119983755 |
| Molecular Formula | C15H29ClN4O2S |
| Molecular Weight | 364.94 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-1-(2-methylpropyl)imidazole-4-sulfonamide;hydrochloride |
| SMILES | CC(C)Cn1cnc(S(=O)(=O)NC(CN)C2CCCCC2)c1.Cl |
| InChI | InChI=1S/C15H28N4O2S.ClH/c1-12(2)9-19-10-15(17-11-19)22(20,21)18-14(8-16)13-6-4-3-5-7-13;/h10-14,18H,3-9,16H2,1-2H3;1H |
| InChIKey | SYIGSTFILJUUIJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.94 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |