About 1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide
1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide (PubChem CID 103931311) has the molecular formula C11H21N3O3S
and a molecular weight of 275.37 g/mol. Its IUPAC name is 1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide |
| PubChem CID | 103931311 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide |
| SMILES | CCn1cnc(S(=O)(=O)NC(C)(C)C(C)(C)O)c1 |
| InChI | InChI=1S/C11H21N3O3S/c1-6-14-7-9(12-8-14)18(16,17)13-10(2,3)11(4,5)15/h7-8,13,15H,6H2,1-5H3 |
| InChIKey | KLISPLCIWUVSFI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide?
The IUPAC name of 1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide (CID 103931311) is 1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide.
What is the SMILES notation for 1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide?
The canonical SMILES for 1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide is CCn1cnc(S(=O)(=O)NC(C)(C)C(C)(C)O)c1.
What is the InChIKey of 1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide?
The InChIKey is KLISPLCIWUVSFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O3S/c1-6-14-7-9(12-8-14)18(16,17)13-10(2,3)11(4,5)15/h7-8,13,15H,6H2,1-5H3.
What are the key properties of 1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide?
1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide has a molecular weight of 275.37 g/mol, XLogP of 0.73, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N-(3-hydroxy-2,3-dimethylbutan-2-yl)imidazole-4-sulfonamide is sourced from PubChem (CID 103931311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).