C14H18ClN3O2S — CID 65033281
N-(2-chloro-2-phenylethyl)-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 65033281) has the molecular formula C14H18ClN3O2S and a molecular weight of 327.84 g/mol. Its IUPAC name is N-(2-chloro-2-phenylethyl)-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N-(2-chloro-2-phenylethyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 65033281 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-(2-chloro-2-phenylethyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)NCC(Cl)c1ccccc1 |
| InChI | InChI=1S/C14H18ClN3O2S/c1-10-14(11(2)18(3)17-10)21(19,20)16-9-13(15)12-7-5-4-6-8-12/h4-8,13,16H,9H2,1-3H3 |
| InChIKey | OBLHJWKMNZMUQX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|