C11H20BrN3O2S — CID 113271242
N-(4-bromo-2-methylbutyl)-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 113271242) has the molecular formula C11H20BrN3O2S and a molecular weight of 338.27 g/mol. Its IUPAC name is N-(4-bromo-2-methylbutyl)-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N-(4-bromo-2-methylbutyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 113271242 |
| Molecular Formula | C11H20BrN3O2S |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | N-(4-bromo-2-methylbutyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)NCC(C)CCBr |
| InChI | InChI=1S/C11H20BrN3O2S/c1-8(5-6-12)7-13-18(16,17)11-9(2)14-15(4)10(11)3/h8,13H,5-7H2,1-4H3 |
| InChIKey | PAUZKVLEUYYSFP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|