C10H16N4O2S — CID 62653855
N-(2-cyanopropyl)-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 62653855) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-(2-cyanopropyl)-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N-(2-cyanopropyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 62653855 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-(2-cyanopropyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)NCC(C)C#N |
| InChI | InChI=1S/C10H16N4O2S/c1-7(5-11)6-12-17(15,16)10-8(2)13-14(4)9(10)3/h7,12H,6H2,1-4H3 |
| InChIKey | WDZFVTNKAHUMCW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |